C16H20ClN3O3 — CID 124606987
methyl 3-[[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]amino]-5-chlorobenzoate (PubChem CID 124606987) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is methyl 3-[[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]amino]-5-chlorobenzoate.
| Compound Name | methyl 3-[[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]amino]-5-chlorobenzoate |
|---|---|
| PubChem CID | 124606987 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | methyl 3-[[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]amino]-5-chlorobenzoate |
| SMILES | COC(=O)c1cc(Cl)cc(NC(=O)N2CCN3CCC[C@H]3C2)c1 |
| InChI | InChI=1S/C16H20ClN3O3/c1-23-15(21)11-7-12(17)9-13(8-11)18-16(22)20-6-5-19-4-2-3-14(19)10-20/h7-9,14H,2-6,10H2,1H3,(H,18,22)/t14-/m0/s1 |
| InChIKey | MOWYZBXKOZZJCR-AWEZNQCLSA-N |
| XLogP | 2.44 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |