C11H13N5O2S — CID 11437425
5-(5-thiophen-2-yltetrazol-2-yl)piperidine-2-carboxylic acid (PubChem CID 11437425) has the molecular formula C11H13N5O2S and a molecular weight of 279.32 g/mol. Its IUPAC name is 5-(5-thiophen-2-yltetrazol-2-yl)piperidine-2-carboxylic acid.
| Compound Name | 5-(5-thiophen-2-yltetrazol-2-yl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 11437425 |
| Molecular Formula | C11H13N5O2S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 5-(5-thiophen-2-yltetrazol-2-yl)piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(n2nnc(-c3cccs3)n2)CN1 |
| InChI | InChI=1S/C11H13N5O2S/c17-11(18)8-4-3-7(6-12-8)16-14-10(13-15-16)9-2-1-5-19-9/h1-2,5,7-8,12H,3-4,6H2,(H,17,18) |
| InChIKey | JFSFKZPTTQGGIQ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |