C21H22N6O2S — CID 92823129
(3S)-1-(2-methylphenyl)-3-[4-(5-thiophen-2-yltetrazol-2-yl)piperidin-1-yl]pyrrolidine-2,5-dione (PubChem CID 92823129) has the molecular formula C21H22N6O2S and a molecular weight of 422.51 g/mol. Its IUPAC name is (3S)-1-(2-methylphenyl)-3-[4-(5-thiophen-2-yltetrazol-2-yl)piperidin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(2-methylphenyl)-3-[4-(5-thiophen-2-yltetrazol-2-yl)piperidin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 92823129 |
| Molecular Formula | C21H22N6O2S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (3S)-1-(2-methylphenyl)-3-[4-(5-thiophen-2-yltetrazol-2-yl)piperidin-1-yl]pyrrolidine-2,5-dione |
| SMILES | Cc1ccccc1N1C(=O)C[C@H](N2CCC(n3nnc(-c4cccs4)n3)CC2)C1=O |
| InChI | InChI=1S/C21H22N6O2S/c1-14-5-2-3-6-16(14)26-19(28)13-17(21(26)29)25-10-8-15(9-11-25)27-23-20(22-24-27)18-7-4-12-30-18/h2-7,12,15,17H,8-11,13H2,1H3/t17-/m0/s1 |
| InChIKey | ZKYOKAHZFHGYDJ-KRWDZBQOSA-N |
| XLogP | 2.68 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|