C25H28N6O5 — CID 92823149
(3S)-3-[4-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]piperidin-1-yl]-1-(4-methoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 92823149) has the molecular formula C25H28N6O5 and a molecular weight of 492.54 g/mol. Its IUPAC name is (3S)-3-[4-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]piperidin-1-yl]-1-(4-methoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[4-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]piperidin-1-yl]-1-(4-methoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 92823149 |
| Molecular Formula | C25H28N6O5 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | (3S)-3-[4-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]piperidin-1-yl]-1-(4-methoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C[C@H](N3CCC(n4nnc(-c5ccc(OC)c(OC)c5)n4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C25H28N6O5/c1-34-19-7-5-17(6-8-19)30-23(32)15-20(25(30)33)29-12-10-18(11-13-29)31-27-24(26-28-31)16-4-9-21(35-2)22(14-16)36-3/h4-9,14,18,20H,10-13,15H2,1-3H3/t20-/m0/s1 |
| InChIKey | CAHMQNPFCVUHMK-FQEVSTJZSA-N |
| XLogP | 2.33 |
| TPSA | 111.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|