C24H26F2N2O3 — CID 5306088
3-[4-[2-(3,5-difluorophenyl)ethyl]piperidin-1-yl]-1-(4-methoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 5306088) has the molecular formula C24H26F2N2O3 and a molecular weight of 428.48 g/mol. Its IUPAC name is 3-[4-[2-(3,5-difluorophenyl)ethyl]piperidin-1-yl]-1-(4-methoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[4-[2-(3,5-difluorophenyl)ethyl]piperidin-1-yl]-1-(4-methoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 5306088 |
| Molecular Formula | C24H26F2N2O3 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 3-[4-[2-(3,5-difluorophenyl)ethyl]piperidin-1-yl]-1-(4-methoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1ccc(N2C(=O)CC(N3CCC(CCc4cc(F)cc(F)c4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C24H26F2N2O3/c1-31-21-6-4-20(5-7-21)28-23(29)15-22(24(28)30)27-10-8-16(9-11-27)2-3-17-12-18(25)14-19(26)13-17/h4-7,12-14,16,22H,2-3,8-11,15H2,1H3 |
| InChIKey | IPWHZSURTCABRP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|