C23H23ClF2N2O2 — CID 5306089
1-(4-chlorophenyl)-3-[4-[2-(3,5-difluorophenyl)ethyl]piperidin-1-yl]pyrrolidine-2,5-dione (PubChem CID 5306089) has the molecular formula C23H23ClF2N2O2 and a molecular weight of 432.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-[2-(3,5-difluorophenyl)ethyl]piperidin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-(4-chlorophenyl)-3-[4-[2-(3,5-difluorophenyl)ethyl]piperidin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 5306089 |
| Molecular Formula | C23H23ClF2N2O2 |
| Molecular Weight | 432.90 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-[2-(3,5-difluorophenyl)ethyl]piperidin-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2CCC(CCc3cc(F)cc(F)c3)CC2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23ClF2N2O2/c24-17-3-5-20(6-4-17)28-22(29)14-21(23(28)30)27-9-7-15(8-10-27)1-2-16-11-18(25)13-19(26)12-16/h3-6,11-13,15,21H,1-2,7-10,14H2 |
| InChIKey | CMRPYUAFIZDBOK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.90 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|