C26H29N3OS — CID 3565216
N-(3,5-dimethylphenyl)-2-(3-phenylprop-2-ynoyl)-2,8-diazaspiro[4.5]decane-8-carbothioamide (PubChem CID 3565216) has the molecular formula C26H29N3OS and a molecular weight of 431.61 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-(3-phenylprop-2-ynoyl)-2,8-diazaspiro[4.5]decane-8-carbothioamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-(3-phenylprop-2-ynoyl)-2,8-diazaspiro[4.5]decane-8-carbothioamide |
|---|---|
| PubChem CID | 3565216 |
| Molecular Formula | C26H29N3OS |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-(3-phenylprop-2-ynoyl)-2,8-diazaspiro[4.5]decane-8-carbothioamide |
| SMILES | Cc1cc(C)cc(NC(=S)N2CCC3(CCN(C(=O)C#Cc4ccccc4)C3)CC2)c1 |
| InChI | InChI=1S/C26H29N3OS/c1-20-16-21(2)18-23(17-20)27-25(31)28-13-10-26(11-14-28)12-15-29(19-26)24(30)9-8-22-6-4-3-5-7-22/h3-7,16-18H,10-15,19H2,1-2H3,(H,27,31) |
| InChIKey | GFESTWNZAYRSAE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|