C25H33N3O4 — CID 3718479
methyl 4-methyl-2-[[8-(3-phenylprop-2-ynoyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]amino]pentanoate (PubChem CID 3718479) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is methyl 4-methyl-2-[[8-(3-phenylprop-2-ynoyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]amino]pentanoate.
| Compound Name | methyl 4-methyl-2-[[8-(3-phenylprop-2-ynoyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 3718479 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | methyl 4-methyl-2-[[8-(3-phenylprop-2-ynoyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]amino]pentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)N1CCC2(CCN(C(=O)C#Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C25H33N3O4/c1-19(2)17-21(23(30)32-3)26-24(31)28-16-13-25(18-28)11-14-27(15-12-25)22(29)10-9-20-7-5-4-6-8-20/h4-8,19,21H,11-18H2,1-3H3,(H,26,31) |
| InChIKey | POFJZWCWDAWMPC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|