C24H32N6O3S — CID 3747386
N-(3,5-dimethylphenyl)-2-[3-(2-methyl-4-nitroimidazol-1-yl)propanoyl]-2,8-diazaspiro[4.5]decane-8-carbothioamide (PubChem CID 3747386) has the molecular formula C24H32N6O3S and a molecular weight of 484.63 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[3-(2-methyl-4-nitroimidazol-1-yl)propanoyl]-2,8-diazaspiro[4.5]decane-8-carbothioamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[3-(2-methyl-4-nitroimidazol-1-yl)propanoyl]-2,8-diazaspiro[4.5]decane-8-carbothioamide |
|---|---|
| PubChem CID | 3747386 |
| Molecular Formula | C24H32N6O3S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[3-(2-methyl-4-nitroimidazol-1-yl)propanoyl]-2,8-diazaspiro[4.5]decane-8-carbothioamide |
| SMILES | Cc1cc(C)cc(NC(=S)N2CCC3(CCN(C(=O)CCn4cc([N+](=O)[O-])nc4C)C3)CC2)c1 |
| InChI | InChI=1S/C24H32N6O3S/c1-17-12-18(2)14-20(13-17)26-23(34)27-9-5-24(6-10-27)7-11-29(16-24)22(31)4-8-28-15-21(30(32)33)25-19(28)3/h12-15H,4-11,16H2,1-3H3,(H,26,34) |
| InChIKey | BXLORIZBESXJLZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|