C17H22ClN3O3S2 — CID 112769589
N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-3-(1-thiophen-2-ylethylamino)propanamide (PubChem CID 112769589) has the molecular formula C17H22ClN3O3S2 and a molecular weight of 415.97 g/mol. Its IUPAC name is N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-3-(1-thiophen-2-ylethylamino)propanamide.
| Compound Name | N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-3-(1-thiophen-2-ylethylamino)propanamide |
|---|---|
| PubChem CID | 112769589 |
| Molecular Formula | C17H22ClN3O3S2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-3-(1-thiophen-2-ylethylamino)propanamide |
| SMILES | CC(NCCC(=O)Nc1cc(S(=O)(=O)N(C)C)ccc1Cl)c1cccs1 |
| InChI | InChI=1S/C17H22ClN3O3S2/c1-12(16-5-4-10-25-16)19-9-8-17(22)20-15-11-13(6-7-14(15)18)26(23,24)21(2)3/h4-7,10-12,19H,8-9H2,1-3H3,(H,20,22) |
| InChIKey | NCBPIJXMGCIPBR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |