C15H14ClFN2O3S — CID 4250932
N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-3-fluorobenzamide (PubChem CID 4250932) has the molecular formula C15H14ClFN2O3S and a molecular weight of 356.81 g/mol. Its IUPAC name is N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-3-fluorobenzamide.
| Compound Name | N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 4250932 |
| Molecular Formula | C15H14ClFN2O3S |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-3-fluorobenzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(NC(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C15H14ClFN2O3S/c1-19(2)23(21,22)12-6-7-13(16)14(9-12)18-15(20)10-4-3-5-11(17)8-10/h3-9H,1-2H3,(H,18,20) |
| InChIKey | UDICIQCSLSIGEQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |