C12H10ClNO2S2 — CID 107026835
N-(2-chloro-5-methoxyphenyl)-4-sulfanylthiophene-2-carboxamide (PubChem CID 107026835) has the molecular formula C12H10ClNO2S2 and a molecular weight of 299.80 g/mol. Its IUPAC name is N-(2-chloro-5-methoxyphenyl)-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-(2-chloro-5-methoxyphenyl)-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107026835 |
| Molecular Formula | C12H10ClNO2S2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | N-(2-chloro-5-methoxyphenyl)-4-sulfanylthiophene-2-carboxamide |
| SMILES | COc1ccc(Cl)c(NC(=O)c2cc(S)cs2)c1 |
| InChI | InChI=1S/C12H10ClNO2S2/c1-16-7-2-3-9(13)10(4-7)14-12(15)11-5-8(17)6-18-11/h2-6,17H,1H3,(H,14,15) |
| InChIKey | YCXGJUDFPWHEKR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|