C11H9FN6O3 — CID 107378095
N-(2-fluoro-5-nitrophenyl)-5-hydrazinylpyrazine-2-carboxamide (PubChem CID 107378095) has the molecular formula C11H9FN6O3 and a molecular weight of 292.23 g/mol. Its IUPAC name is N-(2-fluoro-5-nitrophenyl)-5-hydrazinylpyrazine-2-carboxamide.
| Compound Name | N-(2-fluoro-5-nitrophenyl)-5-hydrazinylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107378095 |
| Molecular Formula | C11H9FN6O3 |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | N-(2-fluoro-5-nitrophenyl)-5-hydrazinylpyrazine-2-carboxamide |
| SMILES | NNc1cnc(C(=O)Nc2cc([N+](=O)[O-])ccc2F)cn1 |
| InChI | InChI=1S/C11H9FN6O3/c12-7-2-1-6(18(20)21)3-8(7)16-11(19)9-4-15-10(17-13)5-14-9/h1-5H,13H2,(H,15,17)(H,16,19) |
| InChIKey | SGHZIJQJXWRCPR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|