C11H6FN3O6 — CID 107369206
3-[(2-fluoro-5-nitrophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid (PubChem CID 107369206) has the molecular formula C11H6FN3O6 and a molecular weight of 295.18 g/mol. Its IUPAC name is 3-[(2-fluoro-5-nitrophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-[(2-fluoro-5-nitrophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 107369206 |
| Molecular Formula | C11H6FN3O6 |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 3-[(2-fluoro-5-nitrophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1F)c1cc(C(=O)O)on1 |
| InChI | InChI=1S/C11H6FN3O6/c12-6-2-1-5(15(19)20)3-7(6)13-10(16)8-4-9(11(17)18)21-14-8/h1-4H,(H,13,16)(H,17,18) |
| InChIKey | XQUBQLIHPRZGJR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 135.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|