C17H17ClN2O — CID 20872301
2-chloro-6-methyl-N-[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]pyridine-3-carboxamide (PubChem CID 20872301) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is 2-chloro-6-methyl-N-[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-6-methyl-N-[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 20872301 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-chloro-6-methyl-N-[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)N[C@@H]2CCc3ccccc3C2)c(Cl)n1 |
| InChI | InChI=1S/C17H17ClN2O/c1-11-6-9-15(16(18)19-11)17(21)20-14-8-7-12-4-2-3-5-13(12)10-14/h2-6,9,14H,7-8,10H2,1H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | WLYADQKDROFVMS-CQSZACIVSA-N |
| XLogP | 3.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|