C29H32Cl3N3 — CID 122554559
1-benzyl-N-[1-(7-chloro-2-phenylquinolin-4-yl)ethyl]piperidin-4-amine;dihydrochloride (PubChem CID 122554559) has the molecular formula C29H32Cl3N3 and a molecular weight of 528.96 g/mol. Its IUPAC name is 1-benzyl-N-[1-(7-chloro-2-phenylquinolin-4-yl)ethyl]piperidin-4-amine;dihydrochloride.
| Compound Name | 1-benzyl-N-[1-(7-chloro-2-phenylquinolin-4-yl)ethyl]piperidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 122554559 |
| Molecular Formula | C29H32Cl3N3 |
| Molecular Weight | 528.96 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | 1-benzyl-N-[1-(7-chloro-2-phenylquinolin-4-yl)ethyl]piperidin-4-amine;dihydrochloride |
| SMILES | CC(NC1CCN(Cc2ccccc2)CC1)c1cc(-c2ccccc2)nc2cc(Cl)ccc12.Cl.Cl |
| InChI | InChI=1S/C29H30ClN3.2ClH/c1-21(31-25-14-16-33(17-15-25)20-22-8-4-2-5-9-22)27-19-28(23-10-6-3-7-11-23)32-29-18-24(30)12-13-26(27)29;;/h2-13,18-19,21,25,31H,14-17,20H2,1H3;2*1H |
| InChIKey | AYRFBHVLAGXQKJ-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.96 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |