C29H33Cl2N3 — CID 90459230
1-benzyl-N-[2-(2-phenylquinolin-4-yl)ethyl]piperidin-4-amine;dihydrochloride (PubChem CID 90459230) has the molecular formula C29H33Cl2N3 and a molecular weight of 494.51 g/mol. Its IUPAC name is 1-benzyl-N-[2-(2-phenylquinolin-4-yl)ethyl]piperidin-4-amine;dihydrochloride.
| Compound Name | 1-benzyl-N-[2-(2-phenylquinolin-4-yl)ethyl]piperidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 90459230 |
| Molecular Formula | C29H33Cl2N3 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 1-benzyl-N-[2-(2-phenylquinolin-4-yl)ethyl]piperidin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(CN2CCC(NCCc3cc(-c4ccccc4)nc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C29H31N3.2ClH/c1-3-9-23(10-4-1)22-32-19-16-26(17-20-32)30-18-15-25-21-29(24-11-5-2-6-12-24)31-28-14-8-7-13-27(25)28;;/h1-14,21,26,30H,15-20,22H2;2*1H |
| InChIKey | TVUMWVKEGKUQLO-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |