C31H33N3O — CID 3479625
N-(1-benzylpiperidin-4-yl)-2-(4-ethylphenyl)-6-methylquinoline-4-carboxamide (PubChem CID 3479625) has the molecular formula C31H33N3O and a molecular weight of 463.63 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-(4-ethylphenyl)-6-methylquinoline-4-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-(4-ethylphenyl)-6-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3479625 |
| Molecular Formula | C31H33N3O |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-(4-ethylphenyl)-6-methylquinoline-4-carboxamide |
| SMILES | CCc1ccc(-c2cc(C(=O)NC3CCN(Cc4ccccc4)CC3)c3cc(C)ccc3n2)cc1 |
| InChI | InChI=1S/C31H33N3O/c1-3-23-10-12-25(13-11-23)30-20-28(27-19-22(2)9-14-29(27)33-30)31(35)32-26-15-17-34(18-16-26)21-24-7-5-4-6-8-24/h4-14,19-20,26H,3,15-18,21H2,1-2H3,(H,32,35) |
| InChIKey | IEIHOPVZAAIUQU-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |