C31H32ClN3O — CID 17372353
N-(1-benzylpiperidin-4-yl)-7-chloro-2-(4-ethylphenyl)-8-methylquinoline-4-carboxamide (PubChem CID 17372353) has the molecular formula C31H32ClN3O and a molecular weight of 498.07 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-7-chloro-2-(4-ethylphenyl)-8-methylquinoline-4-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-7-chloro-2-(4-ethylphenyl)-8-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 17372353 |
| Molecular Formula | C31H32ClN3O |
| Molecular Weight | 498.07 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-7-chloro-2-(4-ethylphenyl)-8-methylquinoline-4-carboxamide |
| SMILES | CCc1ccc(-c2cc(C(=O)NC3CCN(Cc4ccccc4)CC3)c3ccc(Cl)c(C)c3n2)cc1 |
| InChI | InChI=1S/C31H32ClN3O/c1-3-22-9-11-24(12-10-22)29-19-27(26-13-14-28(32)21(2)30(26)34-29)31(36)33-25-15-17-35(18-16-25)20-23-7-5-4-6-8-23/h4-14,19,25H,3,15-18,20H2,1-2H3,(H,33,36) |
| InChIKey | CTMLPBXVIPLDRA-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.07 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |