C22H24ClN4O+ — CID 7248332
7-chloro-8-methyl-N-(1-methylpiperidin-1-ium-4-yl)-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 7248332) has the molecular formula C22H24ClN4O+ and a molecular weight of 395.91 g/mol. Its IUPAC name is 7-chloro-8-methyl-N-(1-methylpiperidin-1-ium-4-yl)-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | 7-chloro-8-methyl-N-(1-methylpiperidin-1-ium-4-yl)-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 7248332 |
| Molecular Formula | C22H24ClN4O+ |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 7-chloro-8-methyl-N-(1-methylpiperidin-1-ium-4-yl)-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | Cc1c(Cl)ccc2c(C(=O)NC3CC[NH+](C)CC3)cc(-c3cccnc3)nc12 |
| InChI | InChI=1S/C22H23ClN4O/c1-14-19(23)6-5-17-18(22(28)25-16-7-10-27(2)11-8-16)12-20(26-21(14)17)15-4-3-9-24-13-15/h3-6,9,12-13,16H,7-8,10-11H2,1-2H3,(H,25,28)/p+1 |
| InChIKey | YETORFGBLDHCPO-UHFFFAOYSA-O |
| XLogP | 2.67 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |