C18H21ClN2O — CID 17261236
7-chloro-N-cyclohexyl-2,8-dimethylquinoline-4-carboxamide (PubChem CID 17261236) has the molecular formula C18H21ClN2O and a molecular weight of 316.83 g/mol. Its IUPAC name is 7-chloro-N-cyclohexyl-2,8-dimethylquinoline-4-carboxamide.
| Compound Name | 7-chloro-N-cyclohexyl-2,8-dimethylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 17261236 |
| Molecular Formula | C18H21ClN2O |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 7-chloro-N-cyclohexyl-2,8-dimethylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCCCC2)c2ccc(Cl)c(C)c2n1 |
| InChI | InChI=1S/C18H21ClN2O/c1-11-10-15(18(22)21-13-6-4-3-5-7-13)14-8-9-16(19)12(2)17(14)20-11/h8-10,13H,3-7H2,1-2H3,(H,21,22) |
| InChIKey | PCMMDNYQQWPXAV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |