C18H27ClN2O — CID 143582754
3-chloro-N-cyclohexyl-2-methylbenzamide;pyrrolidine (PubChem CID 143582754) has the molecular formula C18H27ClN2O and a molecular weight of 322.88 g/mol. Its IUPAC name is 3-chloro-N-cyclohexyl-2-methylbenzamide;pyrrolidine.
| Compound Name | 3-chloro-N-cyclohexyl-2-methylbenzamide;pyrrolidine |
|---|---|
| PubChem CID | 143582754 |
| Molecular Formula | C18H27ClN2O |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 3-chloro-N-cyclohexyl-2-methylbenzamide;pyrrolidine |
| SMILES | C1CCNC1.Cc1c(Cl)cccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H18ClNO.C4H9N/c1-10-12(8-5-9-13(10)15)14(17)16-11-6-3-2-4-7-11;1-2-4-5-3-1/h5,8-9,11H,2-4,6-7H2,1H3,(H,16,17);5H,1-4H2 |
| InChIKey | DNPNGEQDFYBSGA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |