C13H17ClN2O — CID 96583038
3-chloro-2-methyl-N-[(3R)-1-methylpyrrolidin-3-yl]benzamide (PubChem CID 96583038) has the molecular formula C13H17ClN2O and a molecular weight of 252.74 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-[(3R)-1-methylpyrrolidin-3-yl]benzamide.
| Compound Name | 3-chloro-2-methyl-N-[(3R)-1-methylpyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 96583038 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-chloro-2-methyl-N-[(3R)-1-methylpyrrolidin-3-yl]benzamide |
| SMILES | Cc1c(Cl)cccc1C(=O)N[C@@H]1CCN(C)C1 |
| InChI | InChI=1S/C13H17ClN2O/c1-9-11(4-3-5-12(9)14)13(17)15-10-6-7-16(2)8-10/h3-5,10H,6-8H2,1-2H3,(H,15,17)/t10-/m1/s1 |
| InChIKey | KEMOJZFUFWIFEP-SNVBAGLBSA-N |
| XLogP | 2.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |