C13H19N3O — CID 54949890
2-(methylamino)-N-(1-methylpyrrolidin-3-yl)benzamide (PubChem CID 54949890) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-(methylamino)-N-(1-methylpyrrolidin-3-yl)benzamide.
| Compound Name | 2-(methylamino)-N-(1-methylpyrrolidin-3-yl)benzamide |
|---|---|
| PubChem CID | 54949890 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 2-(methylamino)-N-(1-methylpyrrolidin-3-yl)benzamide |
| SMILES | CNc1ccccc1C(=O)NC1CCN(C)C1 |
| InChI | InChI=1S/C13H19N3O/c1-14-12-6-4-3-5-11(12)13(17)15-10-7-8-16(2)9-10/h3-6,10,14H,7-9H2,1-2H3,(H,15,17) |
| InChIKey | XZFTZBYKJVBWED-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |