C21H23ClN3O+ — CID 2220589
2-[(7-chloro-8-methyl-2-phenylquinoline-4-carbonyl)amino]ethyl-dimethylazanium (PubChem CID 2220589) has the molecular formula C21H23ClN3O+ and a molecular weight of 368.89 g/mol. Its IUPAC name is 2-[(7-chloro-8-methyl-2-phenylquinoline-4-carbonyl)amino]ethyl-dimethylazanium.
| Compound Name | 2-[(7-chloro-8-methyl-2-phenylquinoline-4-carbonyl)amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 2220589 |
| Molecular Formula | C21H23ClN3O+ |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-[(7-chloro-8-methyl-2-phenylquinoline-4-carbonyl)amino]ethyl-dimethylazanium |
| SMILES | Cc1c(Cl)ccc2c(C(=O)NCC[NH+](C)C)cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C21H22ClN3O/c1-14-18(22)10-9-16-17(21(26)23-11-12-25(2)3)13-19(24-20(14)16)15-7-5-4-6-8-15/h4-10,13H,11-12H2,1-3H3,(H,23,26)/p+1 |
| InChIKey | MRRUYWXOHURUBB-UHFFFAOYSA-O |
| XLogP | 2.74 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |