C22H27BrN2O2 — CID 15167709
N-(1-benzylpiperidin-4-yl)-3-bromo-5-ethyl-2-methoxybenzamide (PubChem CID 15167709) has the molecular formula C22H27BrN2O2 and a molecular weight of 431.37 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-bromo-5-ethyl-2-methoxybenzamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-bromo-5-ethyl-2-methoxybenzamide |
|---|---|
| PubChem CID | 15167709 |
| Molecular Formula | C22H27BrN2O2 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-bromo-5-ethyl-2-methoxybenzamide |
| SMILES | CCc1cc(Br)c(OC)c(C(=O)NC2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H27BrN2O2/c1-3-16-13-19(21(27-2)20(23)14-16)22(26)24-18-9-11-25(12-10-18)15-17-7-5-4-6-8-17/h4-8,13-14,18H,3,9-12,15H2,1-2H3,(H,24,26) |
| InChIKey | NHTFJRAWTIKIJO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |