C24H25BrN2O2 — CID 101346624
N-[[(3R)-1-benzylpyrrolidin-3-yl]methyl]-4-bromo-1-methoxynaphthalene-2-carboxamide (PubChem CID 101346624) has the molecular formula C24H25BrN2O2 and a molecular weight of 453.38 g/mol. Its IUPAC name is N-[[(3R)-1-benzylpyrrolidin-3-yl]methyl]-4-bromo-1-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[[(3R)-1-benzylpyrrolidin-3-yl]methyl]-4-bromo-1-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 101346624 |
| Molecular Formula | C24H25BrN2O2 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | N-[[(3R)-1-benzylpyrrolidin-3-yl]methyl]-4-bromo-1-methoxynaphthalene-2-carboxamide |
| SMILES | COc1c(C(=O)NC[C@H]2CCN(Cc3ccccc3)C2)cc(Br)c2ccccc12 |
| InChI | InChI=1S/C24H25BrN2O2/c1-29-23-20-10-6-5-9-19(20)22(25)13-21(23)24(28)26-14-18-11-12-27(16-18)15-17-7-3-2-4-8-17/h2-10,13,18H,11-12,14-16H2,1H3,(H,26,28)/t18-/m1/s1 |
| InChIKey | CNAWUGXPLJMOSN-GOSISDBHSA-N |
| XLogP | 4.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |