C15H19BrClN3O — CID 119384070
N-(2-aminoethyl)-1-(2-bromophenyl)-2,5-dimethylpyrrole-3-carboxamide;hydrochloride (PubChem CID 119384070) has the molecular formula C15H19BrClN3O and a molecular weight of 372.69 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(2-bromophenyl)-2,5-dimethylpyrrole-3-carboxamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-1-(2-bromophenyl)-2,5-dimethylpyrrole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119384070 |
| Molecular Formula | C15H19BrClN3O |
| Molecular Weight | 372.69 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | N-(2-aminoethyl)-1-(2-bromophenyl)-2,5-dimethylpyrrole-3-carboxamide;hydrochloride |
| SMILES | Cc1cc(C(=O)NCCN)c(C)n1-c1ccccc1Br.Cl |
| InChI | InChI=1S/C15H18BrN3O.ClH/c1-10-9-12(15(20)18-8-7-17)11(2)19(10)14-6-4-3-5-13(14)16;/h3-6,9H,7-8,17H2,1-2H3,(H,18,20);1H |
| InChIKey | CTZCUEUNTFIJBA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.69 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|