C17H22BrN3O — CID 119583586
N-(1-aminopropan-2-yl)-1-(2-bromophenyl)-N,2,5-trimethylpyrrole-3-carboxamide (PubChem CID 119583586) has the molecular formula C17H22BrN3O and a molecular weight of 364.29 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-1-(2-bromophenyl)-N,2,5-trimethylpyrrole-3-carboxamide.
| Compound Name | N-(1-aminopropan-2-yl)-1-(2-bromophenyl)-N,2,5-trimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 119583586 |
| Molecular Formula | C17H22BrN3O |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-(1-aminopropan-2-yl)-1-(2-bromophenyl)-N,2,5-trimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)C(C)CN)c(C)n1-c1ccccc1Br |
| InChI | InChI=1S/C17H22BrN3O/c1-11-9-14(17(22)20(4)12(2)10-19)13(3)21(11)16-8-6-5-7-15(16)18/h5-9,12H,10,19H2,1-4H3 |
| InChIKey | CNTVFFQEOGMJKU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|