C18H23BrN2O3S — CID 99807299
1-(2-bromophenyl)-N,2,5-trimethyl-N-[(2R)-1-methylsulfonylpropan-2-yl]pyrrole-3-carboxamide (PubChem CID 99807299) has the molecular formula C18H23BrN2O3S and a molecular weight of 427.36 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N,2,5-trimethyl-N-[(2R)-1-methylsulfonylpropan-2-yl]pyrrole-3-carboxamide.
| Compound Name | 1-(2-bromophenyl)-N,2,5-trimethyl-N-[(2R)-1-methylsulfonylpropan-2-yl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 99807299 |
| Molecular Formula | C18H23BrN2O3S |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 1-(2-bromophenyl)-N,2,5-trimethyl-N-[(2R)-1-methylsulfonylpropan-2-yl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)[C@H](C)CS(C)(=O)=O)c(C)n1-c1ccccc1Br |
| InChI | InChI=1S/C18H23BrN2O3S/c1-12-10-15(18(22)20(4)13(2)11-25(5,23)24)14(3)21(12)17-9-7-6-8-16(17)19/h6-10,13H,11H2,1-5H3/t13-/m1/s1 |
| InChIKey | JZDDACKULIAKEB-CYBMUJFWSA-N |
| XLogP | 3.36 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|