C22H21BrFN3O2 — CID 46532208
N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 46532208) has the molecular formula C22H21BrFN3O2 and a molecular weight of 458.33 g/mol. Its IUPAC name is N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 46532208 |
| Molecular Formula | C22H21BrFN3O2 |
| Molecular Weight | 458.33 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNC(=O)c1cc(C)n(-c2ccccc2F)c1C |
| InChI | InChI=1S/C22H21BrFN3O2/c1-13-10-16(23)8-9-19(13)26-21(28)12-25-22(29)17-11-14(2)27(15(17)3)20-7-5-4-6-18(20)24/h4-11H,12H2,1-3H3,(H,25,29)(H,26,28) |
| InChIKey | UEQXORWNUMGYCL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|