C20H15ClF4N2O — CID 59808178
N-(2-chloro-5-fluorophenyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide (PubChem CID 59808178) has the molecular formula C20H15ClF4N2O and a molecular weight of 410.80 g/mol. Its IUPAC name is N-(2-chloro-5-fluorophenyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | N-(2-chloro-5-fluorophenyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59808178 |
| Molecular Formula | C20H15ClF4N2O |
| Molecular Weight | 410.80 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | N-(2-chloro-5-fluorophenyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cc(F)ccc2Cl)c(C)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H15ClF4N2O/c1-11-9-14(19(28)26-17-10-13(22)7-8-16(17)21)12(2)27(11)18-6-4-3-5-15(18)20(23,24)25/h3-10H,1-2H3,(H,26,28) |
| InChIKey | TWYPNVMLKZSAEY-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.80 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|