C21H16F3N3OS — CID 11640266
N-(1,3-benzothiazol-2-yl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide (PubChem CID 11640266) has the molecular formula C21H16F3N3OS and a molecular weight of 415.44 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 11640266 |
| Molecular Formula | C21H16F3N3OS |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2nc3ccccc3s2)c(C)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H16F3N3OS/c1-12-11-14(19(28)26-20-25-16-8-4-6-10-18(16)29-20)13(2)27(12)17-9-5-3-7-15(17)21(22,23)24/h3-11H,1-2H3,(H,25,26,28) |
| InChIKey | YDQBMUCWFSAPEM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|