C21H20F3N3O3S — CID 174693626
2-[2-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]-1,3-thiazol-4-yl]ethyl acetate (PubChem CID 174693626) has the molecular formula C21H20F3N3O3S and a molecular weight of 451.47 g/mol. Its IUPAC name is 2-[2-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]-1,3-thiazol-4-yl]ethyl acetate.
| Compound Name | 2-[2-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]-1,3-thiazol-4-yl]ethyl acetate |
|---|---|
| PubChem CID | 174693626 |
| Molecular Formula | C21H20F3N3O3S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 2-[2-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]-1,3-thiazol-4-yl]ethyl acetate |
| SMILES | CC(=O)OCCc1csc(NC(=O)c2cc(C)n(-c3ccccc3C(F)(F)F)c2C)n1 |
| InChI | InChI=1S/C21H20F3N3O3S/c1-12-10-16(13(2)27(12)18-7-5-4-6-17(18)21(22,23)24)19(29)26-20-25-15(11-31-20)8-9-30-14(3)28/h4-7,10-11H,8-9H2,1-3H3,(H,25,26,29) |
| InChIKey | JYPAPPKOTPPFAF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|