C18H16F3N3OS — CID 59808227
2,5-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide (PubChem CID 59808227) has the molecular formula C18H16F3N3OS and a molecular weight of 379.41 g/mol. Its IUPAC name is 2,5-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59808227 |
| Molecular Formula | C18H16F3N3OS |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 2,5-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| SMILES | Cc1cnc(NC(=O)c2cc(C)n(-c3ccccc3C(F)(F)F)c2C)s1 |
| InChI | InChI=1S/C18H16F3N3OS/c1-10-8-13(16(25)23-17-22-9-11(2)26-17)12(3)24(10)15-7-5-4-6-14(15)18(19,20)21/h4-9H,1-3H3,(H,22,23,25) |
| InChIKey | OVXHGQKZXYCUFV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|