C16H17F3IN3O — CID 5306207
4-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-[2-(trifluoromethyl)phenyl]butanamide (PubChem CID 5306207) has the molecular formula C16H17F3IN3O and a molecular weight of 451.23 g/mol. Its IUPAC name is 4-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-[2-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 4-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-[2-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 5306207 |
| Molecular Formula | C16H17F3IN3O |
| Molecular Weight | 451.23 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 4-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-[2-(trifluoromethyl)phenyl]butanamide |
| SMILES | Cc1nn(CCCC(=O)Nc2ccccc2C(F)(F)F)c(C)c1I |
| InChI | InChI=1S/C16H17F3IN3O/c1-10-15(20)11(2)23(22-10)9-5-8-14(24)21-13-7-4-3-6-12(13)16(17,18)19/h3-4,6-7H,5,8-9H2,1-2H3,(H,21,24) |
| InChIKey | GEBXOOJBXQHHOV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.23 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|