C10H9BF6NO- — CID 91759481
trifluoro-[3-oxo-3-[2-(trifluoromethyl)anilino]propyl]boranuide (PubChem CID 91759481) has the molecular formula C10H9BF6NO- and a molecular weight of 283.99 g/mol. Its IUPAC name is trifluoro-[3-oxo-3-[2-(trifluoromethyl)anilino]propyl]boranuide.
| Compound Name | trifluoro-[3-oxo-3-[2-(trifluoromethyl)anilino]propyl]boranuide |
|---|---|
| PubChem CID | 91759481 |
| Molecular Formula | C10H9BF6NO- |
| Molecular Weight | 283.99 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | trifluoro-[3-oxo-3-[2-(trifluoromethyl)anilino]propyl]boranuide |
| SMILES | O=C(CC[B-](F)(F)F)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C10H9BF6NO/c12-10(13,14)7-3-1-2-4-8(7)18-9(19)5-6-11(15,16)17/h1-4H,5-6H2,(H,18,19)/q-1 |
| InChIKey | KPAVIRSMZXLQRF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.99 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|