C16H19F3N4O — CID 71882069
N'-[2-(trifluoromethyl)phenyl]-2-(1,3,5-trimethylpyrazol-4-yl)propanehydrazide (PubChem CID 71882069) has the molecular formula C16H19F3N4O and a molecular weight of 340.35 g/mol. Its IUPAC name is N'-[2-(trifluoromethyl)phenyl]-2-(1,3,5-trimethylpyrazol-4-yl)propanehydrazide.
| Compound Name | N'-[2-(trifluoromethyl)phenyl]-2-(1,3,5-trimethylpyrazol-4-yl)propanehydrazide |
|---|---|
| PubChem CID | 71882069 |
| Molecular Formula | C16H19F3N4O |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N'-[2-(trifluoromethyl)phenyl]-2-(1,3,5-trimethylpyrazol-4-yl)propanehydrazide |
| SMILES | Cc1nn(C)c(C)c1C(C)C(=O)NNc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H19F3N4O/c1-9(14-10(2)22-23(4)11(14)3)15(24)21-20-13-8-6-5-7-12(13)16(17,18)19/h5-9,20H,1-4H3,(H,21,24) |
| InChIKey | ZGKKUOUCGUTJAI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|