C13H13F3N4O — CID 71898167
2-pyrazol-1-yl-N'-[2-(trifluoromethyl)phenyl]propanehydrazide (PubChem CID 71898167) has the molecular formula C13H13F3N4O and a molecular weight of 298.27 g/mol. Its IUPAC name is 2-pyrazol-1-yl-N'-[2-(trifluoromethyl)phenyl]propanehydrazide.
| Compound Name | 2-pyrazol-1-yl-N'-[2-(trifluoromethyl)phenyl]propanehydrazide |
|---|---|
| PubChem CID | 71898167 |
| Molecular Formula | C13H13F3N4O |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-pyrazol-1-yl-N'-[2-(trifluoromethyl)phenyl]propanehydrazide |
| SMILES | CC(C(=O)NNc1ccccc1C(F)(F)F)n1cccn1 |
| InChI | InChI=1S/C13H13F3N4O/c1-9(20-8-4-7-17-20)12(21)19-18-11-6-3-2-5-10(11)13(14,15)16/h2-9,18H,1H3,(H,19,21) |
| InChIKey | JLBTZBFZYHUZCX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|