C9H6ClN3O2 — CID 45497358
4-chloro-N-(1,2-oxazol-3-yl)pyridine-2-carboxamide (PubChem CID 45497358) has the molecular formula C9H6ClN3O2 and a molecular weight of 223.62 g/mol. Its IUPAC name is 4-chloro-N-(1,2-oxazol-3-yl)pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-(1,2-oxazol-3-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 45497358 |
| Molecular Formula | C9H6ClN3O2 |
| Molecular Weight | 223.62 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | 4-chloro-N-(1,2-oxazol-3-yl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccon1)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C9H6ClN3O2/c10-6-1-3-11-7(5-6)9(14)12-8-2-4-15-13-8/h1-5H,(H,12,13,14) |
| InChIKey | ZLCNDJACGTYRDJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.62 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |