C17H15N3O3S3 — CID 19631448
2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 19631448) has the molecular formula C17H15N3O3S3 and a molecular weight of 405.53 g/mol. Its IUPAC name is 2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 19631448 |
| Molecular Formula | C17H15N3O3S3 |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CSc1ccc(NS(=O)(=O)c2ccccc2)cc1)Nc1nccs1 |
| InChI | InChI=1S/C17H15N3O3S3/c21-16(19-17-18-10-11-24-17)12-25-14-8-6-13(7-9-14)20-26(22,23)15-4-2-1-3-5-15/h1-11,20H,12H2,(H,18,19,21) |
| InChIKey | NIBUKISMTXMLLS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |