C29H24N2O2S2 — CID 19300121
1-[3-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylphenyl]-3-(2-methoxyphenyl)thiourea (PubChem CID 19300121) has the molecular formula C29H24N2O2S2 and a molecular weight of 496.66 g/mol. Its IUPAC name is 1-[3-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylphenyl]-3-(2-methoxyphenyl)thiourea.
| Compound Name | 1-[3-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylphenyl]-3-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 19300121 |
| Molecular Formula | C29H24N2O2S2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | 1-[3-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylphenyl]-3-(2-methoxyphenyl)thiourea |
| SMILES | COc1ccccc1NC(=S)Nc1cccc(SCC(=O)c2ccc3c(c2)Cc2ccccc2-3)c1 |
| InChI | InChI=1S/C29H24N2O2S2/c1-33-28-12-5-4-11-26(28)31-29(34)30-22-8-6-9-23(17-22)35-18-27(32)20-13-14-25-21(16-20)15-19-7-2-3-10-24(19)25/h2-14,16-17H,15,18H2,1H3,(H2,30,31,34) |
| InChIKey | SCTHQINBYRMBIT-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|