C24H21NO3S — CID 19299456
(E)-N-[3-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide (PubChem CID 19299456) has the molecular formula C24H21NO3S and a molecular weight of 403.50 g/mol. Its IUPAC name is (E)-N-[3-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[3-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 19299456 |
| Molecular Formula | C24H21NO3S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | (E)-N-[3-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
| SMILES | COc1cccc(C(=O)CSc2cccc(NC(=O)/C=C/c3ccccc3)c2)c1 |
| InChI | InChI=1S/C24H21NO3S/c1-28-21-11-5-9-19(15-21)23(26)17-29-22-12-6-10-20(16-22)25-24(27)14-13-18-7-3-2-4-8-18/h2-16H,17H2,1H3,(H,25,27)/b14-13+ |
| InChIKey | YNJMIONQMZHWPQ-BUHFOSPRSA-N |
| XLogP | 5.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|