C33H30N2O6S — CID 19301293
N-[(Z)-1-(3,4-dimethoxyphenyl)-3-[3-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19301293) has the molecular formula C33H30N2O6S and a molecular weight of 582.68 g/mol. Its IUPAC name is N-[(Z)-1-(3,4-dimethoxyphenyl)-3-[3-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(3,4-dimethoxyphenyl)-3-[3-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19301293 |
| Molecular Formula | C33H30N2O6S |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | N-[(Z)-1-(3,4-dimethoxyphenyl)-3-[3-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(C(=O)CSc2cccc(NC(=O)/C(=C/c3ccc(OC)c(OC)c3)NC(=O)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C33H30N2O6S/c1-39-26-13-7-11-24(19-26)29(36)21-42-27-14-8-12-25(20-27)34-33(38)28(35-32(37)23-9-5-4-6-10-23)17-22-15-16-30(40-2)31(18-22)41-3/h4-20H,21H2,1-3H3,(H,34,38)(H,35,37)/b28-17- |
| InChIKey | RGIQDISVBOADGO-QRQIAZFYSA-N |
| XLogP | 6.10 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|