C24H21N3O3S — CID 18901930
4-[[2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide (PubChem CID 18901930) has the molecular formula C24H21N3O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is 4-[[2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide.
| Compound Name | 4-[[2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 18901930 |
| Molecular Formula | C24H21N3O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 4-[[2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)CSc2cccc(NC(=O)/C=C/c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H21N3O3S/c25-24(30)18-10-12-19(13-11-18)26-23(29)16-31-21-8-4-7-20(15-21)27-22(28)14-9-17-5-2-1-3-6-17/h1-15H,16H2,(H2,25,30)(H,26,29)(H,27,28)/b14-9+ |
| InChIKey | RYNUDHZWOPSRSE-NTEUORMPSA-N |
| XLogP | 4.17 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|