C22H19Cl4N3O5S — CID 18894976
2-[[3-[2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid (PubChem CID 18894976) has the molecular formula C22H19Cl4N3O5S and a molecular weight of 579.29 g/mol. Its IUPAC name is 2-[[3-[2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid.
| Compound Name | 2-[[3-[2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
|---|---|
| PubChem CID | 18894976 |
| Molecular Formula | C22H19Cl4N3O5S |
| Molecular Weight | 579.29 g/mol |
| Exact Mass | 576.98 |
| IUPAC Name | 2-[[3-[2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
| SMILES | NC(=O)C1CCN(C(=O)CSc2cccc(NC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C(=O)O)c2)CC1 |
| InChI | InChI=1S/C22H19Cl4N3O5S/c23-16-14(15(22(33)34)17(24)19(26)18(16)25)21(32)28-11-2-1-3-12(8-11)35-9-13(30)29-6-4-10(5-7-29)20(27)31/h1-3,8,10H,4-7,9H2,(H2,27,31)(H,28,32)(H,33,34) |
| InChIKey | TUPPAAHQECGDHI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.29 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|