C16H10Cl4N2O4S — CID 22784525
2-[[4-(2-amino-2-oxoethyl)sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid (PubChem CID 22784525) has the molecular formula C16H10Cl4N2O4S and a molecular weight of 468.15 g/mol. Its IUPAC name is 2-[[4-(2-amino-2-oxoethyl)sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid.
| Compound Name | 2-[[4-(2-amino-2-oxoethyl)sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
|---|---|
| PubChem CID | 22784525 |
| Molecular Formula | C16H10Cl4N2O4S |
| Molecular Weight | 468.15 g/mol |
| Exact Mass | 465.91 |
| IUPAC Name | 2-[[4-(2-amino-2-oxoethyl)sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
| SMILES | NC(=O)CSc1ccc(NC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)cc1 |
| InChI | InChI=1S/C16H10Cl4N2O4S/c17-11-9(10(16(25)26)12(18)14(20)13(11)19)15(24)22-6-1-3-7(4-2-6)27-5-8(21)23/h1-4H,5H2,(H2,21,23)(H,22,24)(H,25,26) |
| InChIKey | NELHFFQIMMGCDP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.15 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|