C20H11Cl4NO5S — CID 88891408
2-[[4-(benzenesulfonyl)phenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid (PubChem CID 88891408) has the molecular formula C20H11Cl4NO5S and a molecular weight of 519.19 g/mol. Its IUPAC name is 2-[[4-(benzenesulfonyl)phenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid.
| Compound Name | 2-[[4-(benzenesulfonyl)phenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
|---|---|
| PubChem CID | 88891408 |
| Molecular Formula | C20H11Cl4NO5S |
| Molecular Weight | 519.19 g/mol |
| Exact Mass | 516.91 |
| IUPAC Name | 2-[[4-(benzenesulfonyl)phenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
| SMILES | O=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)Nc1ccc(S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H11Cl4NO5S/c21-15-13(14(20(27)28)16(22)18(24)17(15)23)19(26)25-10-6-8-12(9-7-10)31(29,30)11-4-2-1-3-5-11/h1-9H,(H,25,26)(H,27,28) |
| InChIKey | DIXRMAGFTHQCFR-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.19 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|