C17H15Cl2NO3S2 — CID 139781682
2,3-dichloro-6-[(4-propan-2-ylphenyl)carbamoyl]-4,5-bis(sulfanyl)benzoic acid (PubChem CID 139781682) has the molecular formula C17H15Cl2NO3S2 and a molecular weight of 416.35 g/mol. Its IUPAC name is 2,3-dichloro-6-[(4-propan-2-ylphenyl)carbamoyl]-4,5-bis(sulfanyl)benzoic acid.
| Compound Name | 2,3-dichloro-6-[(4-propan-2-ylphenyl)carbamoyl]-4,5-bis(sulfanyl)benzoic acid |
|---|---|
| PubChem CID | 139781682 |
| Molecular Formula | C17H15Cl2NO3S2 |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 2,3-dichloro-6-[(4-propan-2-ylphenyl)carbamoyl]-4,5-bis(sulfanyl)benzoic acid |
| SMILES | CC(C)c1ccc(NC(=O)c2c(S)c(S)c(Cl)c(Cl)c2C(=O)O)cc1 |
| InChI | InChI=1S/C17H15Cl2NO3S2/c1-7(2)8-3-5-9(6-4-8)20-16(21)11-10(17(22)23)12(18)13(19)15(25)14(11)24/h3-7,24-25H,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | RKFOOEZZTSHEEY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|