C29H24Cl2N4O5S — CID 10232620
(2S)-2-[[amino-[4-(benzenesulfonyl)anilino]methylidene]amino]-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoic acid (PubChem CID 10232620) has the molecular formula C29H24Cl2N4O5S and a molecular weight of 611.51 g/mol. Its IUPAC name is (2S)-2-[[amino-[4-(benzenesulfonyl)anilino]methylidene]amino]-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoic acid.
| Compound Name | (2S)-2-[[amino-[4-(benzenesulfonyl)anilino]methylidene]amino]-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 10232620 |
| Molecular Formula | C29H24Cl2N4O5S |
| Molecular Weight | 611.51 g/mol |
| Exact Mass | 610.08 |
| IUPAC Name | (2S)-2-[[amino-[4-(benzenesulfonyl)anilino]methylidene]amino]-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoic acid |
| SMILES | N/C(=N\[C@@H](Cc1ccc(NC(=O)c2c(Cl)cccc2Cl)cc1)C(=O)O)Nc1ccc(S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H24Cl2N4O5S/c30-23-7-4-8-24(31)26(23)27(36)33-19-11-9-18(10-12-19)17-25(28(37)38)35-29(32)34-20-13-15-22(16-14-20)41(39,40)21-5-2-1-3-6-21/h1-16,25H,17H2,(H,33,36)(H,37,38)(H3,32,34,35)/t25-/m0/s1 |
| InChIKey | JZFNHMRNTYOHDX-VWLOTQADSA-N |
| XLogP | 5.50 |
| TPSA | 150.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|